ChemNet > CAS > 2051-49-2 Hexanoic anhydride
2051-49-2 Hexanoic anhydride
| उत्पाद का नाम |
Hexanoic anhydride |
| अंग्रेजी नाम |
Hexanoic anhydride; Caproic anhydride; Hexanoic Acid Anhydride; N-hexanoic anhydride |
| आणविक फार्मूला |
C12H22O3 |
| आण्विक वजन |
214.3013 |
| InChI |
InChI=1/C12H22O3/c1-3-5-7-9-11(13)15-12(14)10-8-6-4-2/h3-10H2,1-2H3 |
| कैस रजिस्टी संख्या |
2051-49-2 |
| EINECS |
218-121-4 |
| आणविक संरचना |
|
| घनत्व |
0.943g/cm3 |
| गलनांक |
-40℃ |
| उबलने का समय |
247°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.436 |
| फ्लैश प्वाइंट |
116.6°C |
| वाष्प का दबाव |
0.0263mmHg at 25°C |
| खतरा प्रतीक |
 C:Corrosive;
|
| खतरे के कोड |
R34:Causes burns.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
