2113-58-8 3-Nitrobiphenyl
उत्पाद का नाम |
3-Nitrobiphenyl |
अंग्रेजी नाम |
3-Nitrobiphenyl; 3-Nitrodiphenyl |
आणविक फार्मूला |
C12H9NO2 |
आण्विक वजन |
199.2054 |
InChI |
InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
कैस रजिस्टी संख्या |
2113-58-8 |
EINECS |
218-305-4 |
आणविक संरचना |
|
घनत्व |
1.196g/cm3 |
गलनांक |
56-60℃ |
उबलने का समय |
339°C at 760 mmHg |
अपवर्तक सूचकांक |
1.605 |
फ्लैश प्वाइंट |
161.4°C |
वाष्प का दबाव |
0.000186mmHg at 25°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R40:Possible risks of irreversible effects.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|