2177-70-0 Phenyl Methacrylate
उत्पाद का नाम |
Phenyl Methacrylate |
अंग्रेजी नाम |
Phenyl Methacrylate; Phenyl
methacrylate, (Methacrylic acid phenyl ester); Methacrylic acid phenyl ester; phenyl 2-methylprop-2-enoate |
आणविक फार्मूला |
C10H10O2 |
आण्विक वजन |
162.1852 |
InChI |
InChI=1/C10H10O2/c1-8(2)10(11)12-9-6-4-3-5-7-9/h3-7H,1H2,2H3 |
कैस रजिस्टी संख्या |
2177-70-0 |
EINECS |
218-542-3 |
आणविक संरचना |
|
घनत्व |
1.046g/cm3 |
उबलने का समय |
249.3°C at 760 mmHg |
अपवर्तक सूचकांक |
1.511 |
फ्लैश प्वाइंट |
97.1°C |
वाष्प का दबाव |
0.0231mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|