ChemNet > CAS > 22590-64-3 3- (ऑक्सिरान-2-यल्मेथॉक्सी) बेंजाल्डिहाइड
22590-64-3 3- (ऑक्सिरान-2-यल्मेथॉक्सी) बेंजाल्डिहाइड
| उत्पाद का नाम |
3- (ऑक्सिरान-2-यल्मेथॉक्सी) बेंजाल्डिहाइड |
| अंग्रेजी नाम |
3-(oxiran-2-ylmethoxy)benzaldehyde; |
| आणविक फार्मूला |
C10H10O3 |
| आण्विक वजन |
178.1846 |
| InChI |
InChI=1/C10H10O3/c11-5-8-2-1-3-9(4-8)12-6-10-7-13-10/h1-5,10H,6-7H2 |
| कैस रजिस्टी संख्या |
22590-64-3 |
| आणविक संरचना |
|
| घनत्व |
1.225g/cm3 |
| उबलने का समय |
318.2°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.581 |
| फ्लैश प्वाइंट |
137.2°C |
| वाष्प का दबाव |
0.000367mmHg at 25°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
