ChemNet > CAS > 2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
| उत्पाद का नाम |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| अंग्रेजी नाम |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate; 3-Acetyl-2,4-dimethyl-5-carbethoxypyrrole; 4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl propanoate |
| आणविक फार्मूला |
C11H15NO3 |
| आण्विक वजन |
209.2417 |
| InChI |
InChI=1/C11H15NO3/c1-5-9(14)15-11-6(2)10(8(4)13)7(3)12-11/h12H,5H2,1-4H3 |
| कैस रजिस्टी संख्या |
2386-26-7 |
| आणविक संरचना |
|
| घनत्व |
1.125g/cm3 |
| गलनांक |
139℃ |
| उबलने का समय |
348.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.517 |
| फ्लैश प्वाइंट |
164.8°C |
| वाष्प का दबाव |
4.89E-05mmHg at 25°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
