ChemNet > CAS > 2393-97-7 Bis-(4-chlorophenylthio)methane
2393-97-7 Bis-(4-chlorophenylthio)methane
| उत्पाद का नाम |
Bis-(4-chlorophenylthio)methane |
| अंग्रेजी नाम |
Bis-(4-chlorophenylthio)methane; Bis(4-chlorophenylthio)methane; 1,1'-(methanediyldisulfanediyl)bis(4-chlorobenzene) |
| आणविक फार्मूला |
C13H10Cl2S2 |
| आण्विक वजन |
301.2545 |
| InChI |
InChI=1/C13H10Cl2S2/c14-10-1-5-12(6-2-10)16-9-17-13-7-3-11(15)4-8-13/h1-8H,9H2 |
| कैस रजिस्टी संख्या |
2393-97-7 |
| आणविक संरचना |
|
| घनत्व |
1.38g/cm3 |
| गलनांक |
45-48℃ |
| उबलने का समय |
420.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.677 |
| फ्लैश प्वाइंट |
192.5°C |
| वाष्प का दबाव |
6.64E-07mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
