ChemNet > CAS > 2423-71-4 2,6-Dimethyl-4-nitrophenol
2423-71-4 2,6-Dimethyl-4-nitrophenol
| उत्पाद का नाम |
2,6-Dimethyl-4-nitrophenol |
| अंग्रेजी नाम |
2,6-Dimethyl-4-nitrophenol; 4-Nitro-2,6-xylenol; 2,6-dimethyl-4-nitrophenolate |
| आणविक फार्मूला |
C8H8NO3 |
| आण्विक वजन |
166.1546 |
| InChI |
InChI=1/C8H9NO3/c1-5-3-7(9(11)12)4-6(2)8(5)10/h3-4,10H,1-2H3/p-1 |
| कैस रजिस्टी संख्या |
2423-71-4 |
| EINECS |
219-353-9 |
| आणविक संरचना |
|
| गलनांक |
164℃ |
| उबलने का समय |
322.8°C at 760 mmHg |
| फ्लैश प्वाइंट |
145.3°C |
| वाष्प का दबाव |
0.000145mmHg at 25°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R41:Risks of serious damage to eyes.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
