2444-37-3 (Methylthio)acetic acid
उत्पाद का नाम |
(Methylthio)acetic acid |
अंग्रेजी नाम |
(Methylthio)acetic acid; NSC 263480; (methylsulfanyl)acetic acid |
आणविक फार्मूला |
C3H6O2S |
आण्विक वजन |
106.1435 |
InChI |
InChI=1/C3H6O2S/c1-6-2-3(4)5/h2H2,1H3,(H,4,5) |
कैस रजिस्टी संख्या |
2444-37-3 |
EINECS |
219-483-6 |
आणविक संरचना |
|
घनत्व |
1.224g/cm3 |
गलनांक |
13-131℃ |
उबलने का समय |
225.9°C at 760 mmHg |
अपवर्तक सूचकांक |
1.5 |
फ्लैश प्वाइंट |
90.4°C |
वाष्प का दबाव |
0.0307mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|