2567-29-5 Bromoethylbiphenyl
उत्पाद का नाम |
Bromoethylbiphenyl |
अंग्रेजी नाम |
Bromoethylbiphenyl; 4-Bromoethylbiphenyl; 4-(Bromomethyl)biphenyl; 4-Phenylbenzyl bromide |
आणविक फार्मूला |
C13H11Br |
आण्विक वजन |
247.1304 |
InChI |
InChI=1/C13H11Br/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2 |
कैस रजिस्टी संख्या |
2567-29-5 |
आणविक संरचना |
|
घनत्व |
1.341g/cm3 |
गलनांक |
86℃ |
उबलने का समय |
333.4°C at 760 mmHg |
अपवर्तक सूचकांक |
1.605 |
फ्लैश प्वाइंट |
161.3°C |
वाष्प का दबाव |
0.000266mmHg at 25°C |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|