ChemNet > CAS > 26782-74-1 (S)-2-chloro-3-methylbutyric acid
26782-74-1 (S)-2-chloro-3-methylbutyric acid
उत्पाद का नाम |
(S)-2-chloro-3-methylbutyric acid |
अंग्रेजी नाम |
(S)-2-chloro-3-methylbutyric acid; (S)-(-)-2-Chloro-3-methylbutyric acid; S-2-chloro-3-methylbutyric acid; (2S)-2-chloro-3-methylbutanoic acid |
आणविक फार्मूला |
C5H9ClO2 |
आण्विक वजन |
136.5768 |
InChI |
InChI=1/C5H9ClO2/c1-3(2)4(6)5(7)8/h3-4H,1-2H3,(H,7,8)/t4-/m0/s1 |
कैस रजिस्टी संख्या |
26782-74-1 |
आणविक संरचना |
|
घनत्व |
1.159g/cm3 |
उबलने का समय |
210.3°C at 760 mmHg |
अपवर्तक सूचकांक |
1.447 |
फ्लैश प्वाइंट |
81°C |
वाष्प का दबाव |
0.0768mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|