2693-46-1 3-Aminofluoranthene
उत्पाद का नाम |
3-Aminofluoranthene |
अंग्रेजी नाम |
3-Aminofluoranthene; 3-Fluoranthenamine; fluoranthen-3-ylamine; fluoranthen-3-amine |
आणविक फार्मूला |
C16H11N |
आण्विक वजन |
217.2652 |
InChI |
InChI=1/C16H11N/c17-15-9-8-13-11-5-2-1-4-10(11)12-6-3-7-14(15)16(12)13/h1-9H,17H2 |
कैस रजिस्टी संख्या |
2693-46-1 |
EINECS |
220-263-7 |
आणविक संरचना |
|
घनत्व |
1.322g/cm3 |
गलनांक |
115-117℃ |
उबलने का समय |
440.8°C at 760 mmHg |
अपवर्तक सूचकांक |
1.904 |
फ्लैश प्वाइंट |
246.2°C |
वाष्प का दबाव |
5.71E-08mmHg at 25°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|