ChemNet > CAS > 27129-87-9 3,5-dimethylbenzyl alcohol
27129-87-9 3,5-dimethylbenzyl alcohol
| उत्पाद का नाम |
3,5-dimethylbenzyl alcohol |
| अंग्रेजी नाम |
3,5-dimethylbenzyl alcohol; 3,5-Dimethylbenzylalcohol; (3,5-dimethylphenyl)methanol |
| आणविक फार्मूला |
C9H12O |
| आण्विक वजन |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-3-8(2)5-9(4-7)6-10/h3-5,10H,6H2,1-2H3 |
| कैस रजिस्टी संख्या |
27129-87-9 |
| EINECS |
248-241-2 |
| आणविक संरचना |
|
| घनत्व |
1.002g/cm3 |
| उबलने का समय |
219.5°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.536 |
| फ्लैश प्वाइंट |
106.7°C |
| वाष्प का दबाव |
0.0689mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
