ChemNet > CAS > 28446-68-6 4-Methoxycinnamonitrile, mixture of cis- and trans isomers
28446-68-6 4-Methoxycinnamonitrile, mixture of cis- and trans isomers
| उत्पाद का नाम |
4-Methoxycinnamonitrile, mixture of cis- and trans isomers |
| अंग्रेजी नाम |
4-Methoxycinnamonitrile, mixture of cis- and trans isomers; 4-Methoxycinnamonitrile; 3-(4-methoxyphenyl)prop-2-enenitrile; (2E)-3-(4-methoxyphenyl)prop-2-enenitrile |
| आणविक फार्मूला |
C10H9NO |
| आण्विक वजन |
159.1846 |
| InChI |
InChI=1/C10H9NO/c1-12-10-6-4-9(5-7-10)3-2-8-11/h2-7H,1H3/b3-2+ |
| कैस रजिस्टी संख्या |
28446-68-6 |
| EINECS |
249-022-4 |
| आणविक संरचना |
|
| घनत्व |
1.077g/cm3 |
| उबलने का समय |
327.8°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.573 |
| फ्लैश प्वाइंट |
131.6°C |
| वाष्प का दबाव |
0.000197mmHg at 25°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21:Harmful by inhalation and in contact with skin.;
|
| सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
