2873-74-7 Glutaryl dichloride
उत्पाद का नाम |
Glutaryl dichloride |
अंग्रेजी नाम |
Glutaryl dichloride; Glutaryl chloride; Pentanedioyl dichloride~1,3-Propanedicarbonyl chloride; pentanedioyl dichloride |
आणविक फार्मूला |
C5H6Cl2O2 |
आण्विक वजन |
169.0059 |
InChI |
InChI=1/C5H6Cl2O2/c6-4(8)2-1-3-5(7)9/h1-3H2 |
कैस रजिस्टी संख्या |
2873-74-7 |
EINECS |
220-711-1 |
आणविक संरचना |
|
घनत्व |
1.319g/cm3 |
उबलने का समय |
217.8°C at 760 mmHg |
अपवर्तक सूचकांक |
1.458 |
फ्लैश प्वाइंट |
106.7°C |
वाष्प का दबाव |
0.13mmHg at 25°C |
खतरा प्रतीक |
C:Corrosive;
|
खतरे के कोड |
R22:Harmful if swallowed.;
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|