ChemNet > CAS > 30955-94-3 2-Acetyl-5-iodothiophene
30955-94-3 2-Acetyl-5-iodothiophene
| उत्पाद का नाम |
2-Acetyl-5-iodothiophene |
| अंग्रेजी नाम |
2-Acetyl-5-iodothiophene;NSC 80387; 1-(5-iodothiophen-2-yl)ethanone |
| आणविक फार्मूला |
C6H5IOS |
| आण्विक वजन |
252.0728 |
| InChI |
InChI=1/C6H5IOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
| कैस रजिस्टी संख्या |
30955-94-3 |
| आणविक संरचना |
|
| घनत्व |
1.902g/cm3 |
| उबलने का समय |
306.2°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.637 |
| फ्लैश प्वाइंट |
139°C |
| वाष्प का दबाव |
0.000785mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
