ChemNet > CAS > 3113-72-2 5-methyl-2-nitrobenzoic acid
3113-72-2 5-methyl-2-nitrobenzoic acid
उत्पाद का नाम |
5-methyl-2-nitrobenzoic acid |
अंग्रेजी नाम |
5-methyl-2-nitrobenzoic acid; 6-Nitro-m-toluic acid; 2-Nitro-5-Methylbenzoicacid; 2-Nitro-5-methylbenzoic acid |
आणविक फार्मूला |
C8H7NO4 |
आण्विक वजन |
181.1455 |
InChI |
InChI=1/C8H7NO4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11) |
कैस रजिस्टी संख्या |
3113-72-2 |
EINECS |
221-481-5 |
आणविक संरचना |
|
घनत्व |
1.392g/cm3 |
गलनांक |
134-136℃ |
उबलने का समय |
367.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.6 |
फ्लैश प्वाइंट |
166.8°C |
वाष्प का दबाव |
4.72E-06mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|