ChemNet > CAS > 3141-25-1 2,3,4-Tribromothiophene
3141-25-1 2,3,4-Tribromothiophene
| उत्पाद का नाम |
2,3,4-Tribromothiophene |
| अंग्रेजी नाम |
2,3,4-Tribromothiophene; |
| आणविक फार्मूला |
C4HBr3S |
| आण्विक वजन |
320.8277 |
| InChI |
InChI=1/C4HBr3S/c5-2-1-8-4(7)3(2)6/h1H |
| कैस रजिस्टी संख्या |
3141-25-1 |
| EINECS |
221-545-2 |
| आणविक संरचना |
|
| घनत्व |
2.516g/cm3 |
| उबलने का समय |
277.5°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.671 |
| फ्लैश प्वाइंट |
121.6°C |
| वाष्प का दबाव |
0.00762mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
