31430-18-9 Nocodazole
उत्पाद का नाम |
Nocodazole |
अंग्रेजी नाम |
Nocodazole; Methyl[5-(2-thienylcarbonyl)-1H-benzimidazol-2-yl]-carbamate; methyl (5-(2-thienylcarbonyl)-1H-benzimidazol-2-yl)carbamate; methyl [6-(thiophen-2-ylcarbonyl)-1H-benzimidazol-2-yl]carbamate |
आणविक फार्मूला |
C14H11N3O3S |
आण्विक वजन |
301.3204 |
InChI |
InChI=1/C14H11N3O3S/c1-20-14(19)17-13-15-9-5-4-8(7-10(9)16-13)12(18)11-3-2-6-21-11/h2-7H,1H3,(H2,15,16,17,19) |
कैस रजिस्टी संख्या |
31430-18-9 |
EINECS |
250-626-5 |
आणविक संरचना |
|
घनत्व |
1.49g/cm3 |
गलनांक |
300-305℃ |
अपवर्तक सूचकांक |
1.731 |
खतरा प्रतीक |
T:Toxic;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
R61:May cause harm to the unborn child.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|