ChemNet > CAS > 3282-11-9 4,4''-Dinitro-p-terphenyl
3282-11-9 4,4''-Dinitro-p-terphenyl
उत्पाद का नाम |
4,4''-Dinitro-p-terphenyl |
अंग्रेजी नाम |
4,4''-Dinitro-p-terphenyl;p-Terphenyl, 4,4''-dinitro-; 4,4''-dinitro-1,1':4',1''-terphenyl |
आणविक फार्मूला |
C18H12N2O4 |
आण्विक वजन |
320.2989 |
InChI |
InChI=1/C18H12N2O4/c21-19(22)17-9-5-15(6-10-17)13-1-2-14(4-3-13)16-7-11-18(12-8-16)20(23)24/h1-12H |
कैस रजिस्टी संख्या |
3282-11-9 |
आणविक संरचना |
|
घनत्व |
1.314g/cm3 |
उबलने का समय |
534.4°C at 760 mmHg |
अपवर्तक सूचकांक |
1.646 |
फ्लैश प्वाइंट |
260.2°C |
वाष्प का दबाव |
5.85E-11mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R20/22:Harmful by inhalation and if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|