ChemNet > CAS > 332-51-4 (4-fluorophenylthio)acetic acid
332-51-4 (4-fluorophenylthio)acetic acid
उत्पाद का नाम |
(4-fluorophenylthio)acetic acid |
अंग्रेजी नाम |
(4-fluorophenylthio)acetic acid; 2-[(4-Fluorophenyl)thio]acetic acid; [(4-fluorophenyl)sulfanyl]acetic acid; [(4-fluorophenyl)sulfanyl]acetate; 2-(4-Fluorophenylthio)acetic acid |
आणविक फार्मूला |
C8H6FO2S |
आण्विक वजन |
185.196 |
InChI |
InChI=1/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
कैस रजिस्टी संख्या |
332-51-4 |
आणविक संरचना |
|
गलनांक |
76-79℃ |
उबलने का समय |
315.4°C at 760 mmHg |
फ्लैश प्वाइंट |
144.5°C |
वाष्प का दबाव |
0.000185mmHg at 25°C |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|