ChemNet > CAS > 33524-31-1 2,5-Dimethoxybenzyl alcohol
33524-31-1 2,5-Dimethoxybenzyl alcohol
उत्पाद का नाम |
2,5-Dimethoxybenzyl alcohol |
अंग्रेजी नाम |
2,5-Dimethoxybenzyl alcohol;(2,5-dimethoxyphenyl)methanol |
आणविक फार्मूला |
C9H12O3 |
आण्विक वजन |
168.1898 |
InChI |
InChI=1/C9H12O3/c1-11-8-3-4-9(12-2)7(5-8)6-10/h3-5,10H,6H2,1-2H3 |
कैस रजिस्टी संख्या |
33524-31-1 |
EINECS |
251-562-0 |
आणविक संरचना |
|
घनत्व |
1.111g/cm3 |
उबलने का समय |
305.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.521 |
फ्लैश प्वाइंट |
127.7°C |
वाष्प का दबाव |
0.000354mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|