ChemNet > CAS > 3365-85-3 4,4''-Diamino-p-terphenyl
3365-85-3 4,4''-Diamino-p-terphenyl
| उत्पाद का नाम |
4,4''-Diamino-p-terphenyl |
| अंग्रेजी नाम |
4,4''-Diamino-p-terphenyl; 4,4''-Diaminoterphenyl; CCRIS 4965; (1,1':4',1''-Terphenyl)-4,4''-diamine; p,p'-Diaminoterphenyl |
| आणविक फार्मूला |
C18H16N2 |
| आण्विक वजन |
260.333 |
| InChI |
InChI=1/C18H16N2/c19-17-9-5-15(6-10-17)13-1-2-14(4-3-13)16-7-11-18(20)12-8-16/h1-12H,19-20H2 |
| कैस रजिस्टी संख्या |
3365-85-3 |
| आणविक संरचना |
|
| घनत्व |
1.159g/cm3 |
| उबलने का समय |
484.2°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.67 |
| फ्लैश प्वाइंट |
296.3°C |
| वाष्प का दबाव |
1.57E-09mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R45:May cause cancer.;
|
| सुरक्षा विवरण |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
