ChemNet > CAS > 34688-70-5 Pentamethylphenylacetonitrile
34688-70-5 Pentamethylphenylacetonitrile
उत्पाद का नाम |
Pentamethylphenylacetonitrile |
अंग्रेजी नाम |
Pentamethylphenylacetonitrile; 2,3,4,5,6-Pentamethylbenzyl cyanide |
आणविक फार्मूला |
C13H17N |
आण्विक वजन |
187.2808 |
InChI |
InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
कैस रजिस्टी संख्या |
34688-70-5 |
आणविक संरचना |
|
घनत्व |
0.95g/cm3 |
गलनांक |
105-107℃ |
उबलने का समय |
325.9°C at 760 mmHg |
अपवर्तक सूचकांक |
1.519 |
फ्लैश प्वाइंट |
160.2°C |
वाष्प का दबाव |
0.000224mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R20/22:Harmful by inhalation and if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|