ChemNet > CAS > 35112-27-7 Ethyl 2,5-dichlorobenzoate
35112-27-7 Ethyl 2,5-dichlorobenzoate
उत्पाद का नाम |
Ethyl 2,5-dichlorobenzoate |
अंग्रेजी नाम |
Ethyl 2,5-dichlorobenzoate; 2,5-Dichlorobenzoic acid ethyl ester |
आणविक फार्मूला |
C9H8Cl2O2 |
आण्विक वजन |
219.0646 |
InChI |
InChI=1/C9H8Cl2O2/c1-2-13-9(12)7-5-6(10)3-4-8(7)11/h3-5H,2H2,1H3 |
कैस रजिस्टी संख्या |
35112-27-7 |
EINECS |
252-373-6 |
आणविक संरचना |
|
घनत्व |
1.305g/cm3 |
उबलने का समय |
281.4°C at 760 mmHg |
अपवर्तक सूचकांक |
1.537 |
फ्लैश प्वाइंट |
116.8°C |
वाष्प का दबाव |
0.00357mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|