35354-37-1 1-Bromo-5-methylhexane
उत्पाद का नाम |
1-Bromo-5-methylhexane |
अंग्रेजी नाम |
1-Bromo-5-methylhexane; |
आणविक फार्मूला |
C7H15Br |
आण्विक वजन |
179.098 |
InChI |
InChI=1/C7H15Br/c1-7(2)5-3-4-6-8/h7H,3-6H2,1-2H3 |
कैस रजिस्टी संख्या |
35354-37-1 |
आणविक संरचना |
|
घनत्व |
1.136g/cm3 |
उबलने का समय |
168°C at 760 mmHg |
अपवर्तक सूचकांक |
1.447 |
फ्लैश प्वाइंट |
48.4°C |
वाष्प का दबाव |
2.18mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|