ChemNet > CAS > 35541-81-2 1,4-cyclohexanedimethanol dibenzoate
35541-81-2 1,4-cyclohexanedimethanol dibenzoate
उत्पाद का नाम |
1,4-cyclohexanedimethanol dibenzoate |
अंग्रेजी नाम |
1,4-cyclohexanedimethanol dibenzoate; 1,4-Cyclohexanedimethanol dibenzoate,mixture of cis and trans; cyclohexane-1,4-diyldimethanediyl dibenzoate; cyclohexane-1,4-diylbis(methylene) dibenzoate |
आणविक फार्मूला |
C22H24O4 |
आण्विक वजन |
352.4236 |
InChI |
InChI=1/C22H24O4/c23-21(19-7-3-1-4-8-19)25-15-17-11-13-18(14-12-17)16-26-22(24)20-9-5-2-6-10-20/h1-10,17-18H,11-16H2 |
कैस रजिस्टी संख्या |
35541-81-2 |
आणविक संरचना |
|
घनत्व |
1.125g/cm3 |
उबलने का समय |
472.9°C at 760 mmHg |
अपवर्तक सूचकांक |
1.549 |
फ्लैश प्वाइंट |
233.7°C |
वाष्प का दबाव |
4.13E-09mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
|
|