ChemNet > CAS > 359-13-7 2,2-difluoroethanol
359-13-7 2,2-difluoroethanol
| उत्पाद का नाम |
2,2-difluoroethanol |
| अंग्रेजी नाम |
2,2-difluoroethanol; Difluoroethanol; chloroacetyl fluoride |
| आणविक फार्मूला |
C2H2ClFO |
| आण्विक वजन |
96.4881 |
| InChI |
InChI=1/C2H2ClFO/c3-1-2(4)5/h1H2 |
| कैस रजिस्टी संख्या |
359-13-7 |
| आणविक संरचना |
|
| घनत्व |
1.277g/cm3 |
| उबलने का समय |
109.2°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.352 |
| फ्लैश प्वाइंट |
19.8°C |
| वाष्प का दबाव |
25.1mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R11:Highly flammable.;
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
