ChemNet > CAS > 35947-10-5 2-Methyl-1-(3-methylphenyl)piperazine
35947-10-5 2-Methyl-1-(3-methylphenyl)piperazine
| उत्पाद का नाम |
2-Methyl-1-(3-methylphenyl)piperazine |
| अंग्रेजी नाम |
2-Methyl-1-(3-methylphenyl)piperazine; 2-Methyl-1-(m-tolyl)-piperazine; (3S)-3-methyl-4-(3-methylphenyl)piperazin-1-ium; (3R)-3-methyl-4-(3-methylphenyl)piperazin-1-ium |
| आणविक फार्मूला |
C12H19N2 |
| आण्विक वजन |
191.2921 |
| InChI |
InChI=1/C12H18N2/c1-10-4-3-5-12(8-10)14-7-6-13-9-11(14)2/h3-5,8,11,13H,6-7,9H2,1-2H3/p+1/t11-/m1/s1 |
| कैस रजिस्टी संख्या |
35947-10-5 |
| EINECS |
252-810-0 |
| आणविक संरचना |
|
| उबलने का समय |
326.9°C at 760 mmHg |
| फ्लैश प्वाइंट |
147.4°C |
| वाष्प का दबाव |
0.00021mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
