ChemNet > CAS > 374898-01-8 (R)-1-(4-Fluorophenyl)ethylamine
374898-01-8 (R)-1-(4-Fluorophenyl)ethylamine
| उत्पाद का नाम |
(R)-1-(4-Fluorophenyl)ethylamine |
| अंग्रेजी नाम |
(R)-1-(4-Fluorophenyl)ethylamine; (R)-(+)-1-(4-Fluorophenyl)ethylamine; (R)-4-Fluoro-alpha-methylbenzylamine; (1R)-1-(4-fluorophenyl)ethanamine |
| आणविक फार्मूला |
C8H10FN |
| आण्विक वजन |
139.1701 |
| InChI |
InChI=1/C8H10FN/c1-6(10)7-2-4-8(9)5-3-7/h2-6H,10H2,1H3/t6-/m1/s1 |
| कैस रजिस्टी संख्या |
374898-01-8 |
| आणविक संरचना |
|
| घनत्व |
1.063g/cm3 |
| उबलने का समय |
185.4°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.512 |
| फ्लैश प्वाइंट |
74°C |
| वाष्प का दबाव |
0.698mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R34:Causes burns.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
