ChemNet > CAS > 37529-27-4 4-heptylaniline
37529-27-4 4-heptylaniline
| उत्पाद का नाम |
4-heptylaniline |
| अंग्रेजी नाम |
4-heptylaniline; Heptylaniline; 4-n-Heptyaniline |
| आणविक फार्मूला |
C13H21N |
| आण्विक वजन |
191.3125 |
| InChI |
InChI=1/C13H21N/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h8-11H,2-7,14H2,1H3 |
| कैस रजिस्टी संख्या |
37529-27-4 |
| आणविक संरचना |
|
| घनत्व |
0.923g/cm3 |
| उबलने का समय |
282.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.522 |
| फ्लैश प्वाइंट |
128.9°C |
| वाष्प का दबाव |
0.00327mmHg at 25°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
