ChemNet > CAS > 3779-29-1 Diethyl 1,1-cyclobutanedicarboxylate
3779-29-1 Diethyl 1,1-cyclobutanedicarboxylate
| उत्पाद का नाम |
Diethyl 1,1-cyclobutanedicarboxylate |
| अंग्रेजी नाम |
Diethyl 1,1-cyclobutanedicarboxylate; 1,1-Cyclobutanedicarboxylic acid diethyl ester; diethyl cyclobutane-1,1-dicarboxylate; Diethyl-1,1-cyclobutane dicarboxylate |
| आणविक फार्मूला |
C10H16O4 |
| आण्विक वजन |
200.2316 |
| InChI |
InChI=1/C10H16O4/c1-3-13-8(11)10(6-5-7-10)9(12)14-4-2/h3-7H2,1-2H3 |
| कैस रजिस्टी संख्या |
3779-29-1 |
| EINECS |
223-239-4 |
| आणविक संरचना |
|
| घनत्व |
1.127g/cm3 |
| उबलने का समय |
224.5°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.469 |
| फ्लैश प्वाइंट |
99.7°C |
| वाष्प का दबाव |
0.0907mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
