ChemNet > CAS > 3893-23-0 Cyclohexylphenylacetonitrile
3893-23-0 Cyclohexylphenylacetonitrile
| उत्पाद का नाम |
Cyclohexylphenylacetonitrile |
| अंग्रेजी नाम |
Cyclohexylphenylacetonitrile; alpha-Phenylcyclohexaneacetonitrile; alpha-Cyclohexylphenylacetonitrile; (2S)-cyclohexyl(phenyl)ethanenitrile; (2R)-cyclohexyl(phenyl)ethanenitrile |
| आणविक फार्मूला |
C14H17N |
| आण्विक वजन |
199.2915 |
| InChI |
InChI=1/C14H17N/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1,3-4,7-8,13-14H,2,5-6,9-10H2/t14-/m0/s1 |
| कैस रजिस्टी संख्या |
3893-23-0 |
| EINECS |
223-442-8 |
| आणविक संरचना |
|
| घनत्व |
1.019g/cm3 |
| गलनांक |
49-55℃ |
| उबलने का समय |
322.5°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.54 |
| फ्लैश प्वाइंट |
156.3°C |
| वाष्प का दबाव |
0.000279mmHg at 25°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|
