ChemNet > CAS > 38939-88-7 3-Chloro-4-nitrotoluene
38939-88-7 3-Chloro-4-nitrotoluene
| उत्पाद का नाम |
3-Chloro-4-nitrotoluene |
| अंग्रेजी नाम |
3-Chloro-4-nitrotoluene;2-chloro-4-methyl-1-nitrobenzene |
| आणविक फार्मूला |
C7H6ClNO2 |
| आण्विक वजन |
171.581 |
| InChI |
InChI=1/C7H6ClNO2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 |
| कैस रजिस्टी संख्या |
38939-88-7 |
| EINECS |
254-199-6 |
| आणविक संरचना |
|
| घनत्व |
1.324g/cm3 |
| गलनांक |
22-27℃ |
| उबलने का समय |
273.4°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.57 |
| फ्लैश प्वाइंट |
119.1°C |
| वाष्प का दबाव |
0.00962mmHg at 25°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
