39635-11-5 3,4-Dihydroxybenzhydrazide

उत्पाद का नाम	3,4-Dihydroxybenzhydrazide
अंग्रेजी नाम	3,4-Dihydroxybenzhydrazide; 3,4-Dihyroxybenzhydraide; 3,4-dihydroxybenzohydrazide
आणविक फार्मूला	C₇H₈N₂O₃
आण्विक वजन	168.15
InChI	InChI=1/C7H8N2O3/c8-9-7(12)4-1-2-5(10)6(11)3-4/h1-3,10-11H,8H2,(H,9,12)
कैस रजिस्टी संख्या	39635-11-5
EINECS	254-550-3
आणविक संरचना
घनत्व	1.477g/cm³
अपवर्तक सूचकांक	1.67
खतरा प्रतीक
खतरे के कोड	R36/37/38:Irritating to eyes, respiratory system and skin.;
सुरक्षा विवरण	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;