ChemNet > CAS > 3964-57-6 Methyl 3-chloro-4-hydroxybenzoate
3964-57-6 Methyl 3-chloro-4-hydroxybenzoate
| उत्पाद का नाम |
Methyl 3-chloro-4-hydroxybenzoate |
| अंग्रेजी नाम |
Methyl 3-chloro-4-hydroxybenzoate; 3-Chloro-4-hydroxybenzoic acid methyl ester; Methyl 3-chloro-4-hydroxy benzoate |
| आणविक फार्मूला |
C8H7ClO3 |
| आण्विक वजन |
186.5924 |
| InChI |
InChI=1/C8H7ClO3/c1-12-8(11)5-2-3-7(10)6(9)4-5/h2-4,10H,1H3 |
| कैस रजिस्टी संख्या |
3964-57-6 |
| EINECS |
223-573-0 |
| आणविक संरचना |
|
| घनत्व |
1.354g/cm3 |
| गलनांक |
106-107℃ |
| उबलने का समय |
284.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.564 |
| फ्लैश प्वाइंट |
126.1°C |
| वाष्प का दबाव |
0.00168mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
