ChemNet > CAS > 39828-35-8 2,4- dimethoxybenzoyl chloride
39828-35-8 2,4- dimethoxybenzoyl chloride
उत्पाद का नाम |
2,4- dimethoxybenzoyl chloride |
अंग्रेजी नाम |
2,4- dimethoxybenzoyl chloride; 2,4-DIMETHOXYBENZOYL CHLORIDE; benzoyl chloride, 2,4-dimethoxy- |
आणविक फार्मूला |
C9H9ClO3 |
आण्विक वजन |
200.619 |
InChI |
InChI=1/C9H9ClO3/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3 |
कैस रजिस्टी संख्या |
39828-35-8 |
आणविक संरचना |
|
घनत्व |
1.224g/cm3 |
गलनांक |
58℃ |
उबलने का समय |
306.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.52 |
फ्लैश प्वाइंट |
134.1°C |
वाष्प का दबाव |
0.000757mmHg at 25°C |
खतरा प्रतीक |
C:Corrosive;
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|