ChemNet > CAS > 4004-95-9 1-फेनिलपाइपरज़ीन डाइहाइड्रोक्लोराइड
4004-95-9 1-फेनिलपाइपरज़ीन डाइहाइड्रोक्लोराइड
| उत्पाद का नाम |
1-फेनिलपाइपरज़ीन डाइहाइड्रोक्लोराइड |
| समानार्थी |
1-फेनिलपाइपरज़ीन डाइहाइड्रोक्लोराइड; 1-फेनिलपाइपरज़ीन एचसीएल |
| अंग्रेजी नाम |
1-phenylpiperazine dihydrochloride;1-Phenylpiperazine dihydrochloride; 1-Phenylpiperazine HCl |
| आणविक फार्मूला |
C10H16Cl2N2 |
| आण्विक वजन |
235.1534 |
| InChI |
InChI=1/C10H14N2.2ClH/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;;/h1-5,11H,6-9H2;2*1H |
| कैस रजिस्टी संख्या |
4004-95-9 |
| EINECS |
223-654-0 |
| आणविक संरचना |
|
| उबलने का समय |
287.2°C at 760 mmHg |
| फ्लैश प्वाइंट |
138.3°C |
| वाष्प का दबाव |
0.00252mmHg at 25°C |
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|