ChemNet > CAS > 40594-30-7 2,4-difluorophenylhydrazine
40594-30-7 2,4-difluorophenylhydrazine
| उत्पाद का नाम |
2,4-difluorophenylhydrazine |
| अंग्रेजी नाम |
2,4-difluorophenylhydrazine; 1-(2,4-Difluorophenyl)hydrazine; (2,4-difluorophenyl)hydrazine hydrochloride |
| आणविक फार्मूला |
C6H7ClF2N2 |
| आण्विक वजन |
180.583 |
| InChI |
InChI=1/C6H6F2N2.ClH/c7-4-1-2-6(10-9)5(8)3-4;/h1-3,10H,9H2;1H |
| कैस रजिस्टी संख्या |
40594-30-7 |
| आणविक संरचना |
|
| गलनांक |
65-67℃ |
| उबलने का समय |
185.1°C at 760 mmHg |
| फ्लैश प्वाइंट |
65.7°C |
| वाष्प का दबाव |
0.71mmHg at 25°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
