ChemNet > CAS > 4151-80-8 4,4'-Biphenyldiboronic acid
4151-80-8 4,4'-Biphenyldiboronic acid
उत्पाद का नाम |
4,4'-Biphenyldiboronic acid |
अंग्रेजी नाम |
4,4'-Biphenyldiboronic acid;biphenyl-4,4'-diyldiboronic acid |
आणविक फार्मूला |
C12H12B2O4 |
आण्विक वजन |
241.8433 |
InChI |
InChI=1/C12H12B2O4/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18/h1-8,15-18H |
कैस रजिस्टी संख्या |
4151-80-8 |
आणविक संरचना |
|
घनत्व |
1.31g/cm3 |
गलनांक |
300℃ (dec.) |
उबलने का समय |
505.9°C at 760 mmHg |
अपवर्तक सूचकांक |
1.62 |
फ्लैश प्वाइंट |
259.7°C |
वाष्प का दबाव |
4.69E-11mmHg at 25°C |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|