ChemNet > CAS > 42521-08-4 2,6-Dichloropyridine-4-carbonyl chloride
42521-08-4 2,6-Dichloropyridine-4-carbonyl chloride
उत्पाद का नाम |
2,6-Dichloropyridine-4-carbonyl chloride |
अंग्रेजी नाम |
2,6-Dichloropyridine-4-carbonyl chloride; 2,6-Dichloropyridine-4-carboxylic chloride |
आणविक फार्मूला |
C6H2Cl3NO |
आण्विक वजन |
210.4452 |
InChI |
InChI=1/C6H2Cl3NO/c7-4-1-3(6(9)11)2-5(8)10-4/h1-2H |
कैस रजिस्टी संख्या |
42521-08-4 |
आणविक संरचना |
|
घनत्व |
1.582g/cm3 |
उबलने का समय |
280.4°C at 760 mmHg |
अपवर्तक सूचकांक |
1.582 |
फ्लैश प्वाइंट |
123.4°C |
वाष्प का दबाव |
0.0038mmHg at 25°C |
खतरा प्रतीक |
C:Corrosive;
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|