ChemNet > CAS > 43088-42-2 Ethyl 2-amino-4-methylthiophene-3-carboxylate
43088-42-2 Ethyl 2-amino-4-methylthiophene-3-carboxylate
उत्पाद का नाम |
Ethyl 2-amino-4-methylthiophene-3-carboxylate |
अंग्रेजी नाम |
Ethyl 2-amino-4-methylthiophene-3-carboxylate; 2-Amino-4-methylthiophene-3-carboxylic acid ethyl ester |
आणविक फार्मूला |
C8H11NO2S |
आण्विक वजन |
185.2434 |
InChI |
InChI=1/C8H11NO2S/c1-3-11-8(10)6-5(2)4-12-7(6)9/h4H,3,9H2,1-2H3 |
कैस रजिस्टी संख्या |
43088-42-2 |
आणविक संरचना |
|
घनत्व |
1.219g/cm3 |
गलनांक |
72℃ |
उबलने का समय |
279.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.573 |
फ्लैश प्वाइंट |
122.6°C |
वाष्प का दबाव |
0.00411mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|