ChemNet > CAS > 4347-31-3 2-Formylthiophene-3-boronic acid
4347-31-3 2-Formylthiophene-3-boronic acid
| उत्पाद का नाम |
2-Formylthiophene-3-boronic acid |
| अंग्रेजी नाम |
2-Formylthiophene-3-boronic acid; 3-Boronothiophene-2-carboxaldehyde; (2-Formyl-3-thienyl)boronic acid; (2-formylthiophen-3-yl)boronic acid |
| आणविक फार्मूला |
C5H5BO3S |
| आण्विक वजन |
155.9674 |
| InChI |
InChI=1/C5H5BO3S/c7-3-5-4(6(8)9)1-2-10-5/h1-3,8-9H |
| कैस रजिस्टी संख्या |
4347-31-3 |
| आणविक संरचना |
|
| घनत्व |
1.41g/cm3 |
| गलनांक |
167-173℃ |
| उबलने का समय |
396.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.573 |
| फ्लैश प्वाइंट |
193.7°C |
| वाष्प का दबाव |
5.27E-07mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
