4441-63-8 Cyclohexanebutyric acid
उत्पाद का नाम |
Cyclohexanebutyric acid |
अंग्रेजी नाम |
Cyclohexanebutyric acid; 4-Cyclohexylbutyric acid; cadmium bis(4-cyclohexylbutanoate); sodium 4-cyclohexylbutanoate; lead(2+) bis(4-cyclohexylbutanoate); lithium 4-cyclohexylbutanoate; mercury bis(4-cyclohexylbutanoate); potassium 4-cyclohexylbutanoate; silver(1+) 4-cyclohexylbutanoate; strontium bis(4-cyclohexylbutanoate); magnesium bis(4-cyclohexylbutanoate); 4-cyclohexylbutanoate |
आणविक फार्मूला |
C10H17O2 |
आण्विक वजन |
169.2413 |
InChI |
InChI=1/C10H18O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h9H,1-8H2,(H,11,12)/p-1 |
कैस रजिस्टी संख्या |
4441-63-8 |
EINECS |
224-665-3 |
आणविक संरचना |
|
गलनांक |
27-31℃ |
उबलने का समय |
283.3°C at 760 mmHg |
फ्लैश प्वाइंट |
138.9°C |
वाष्प का दबाव |
0.000831mmHg at 25°C |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|