ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
उत्पाद का नाम |
2-aminothiophene-3-carbonitrile |
अंग्रेजी नाम |
2-aminothiophene-3-carbonitrile; 2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
आणविक फार्मूला |
C5H4N2S |
आण्विक वजन |
124.1637 |
InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
कैस रजिस्टी संख्या |
4651-82-5 |
आणविक संरचना |
|
घनत्व |
1.33g/cm3 |
गलनांक |
104℃ |
उबलने का समय |
317.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.627 |
फ्लैश प्वाइंट |
145.8°C |
वाष्प का दबाव |
0.000384mmHg at 25°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|