ChemNet > CAS > 4712-55-4 Diphenyl phosphite
4712-55-4 Diphenyl phosphite
| उत्पाद का नाम |
Diphenyl phosphite |
| अंग्रेजी नाम |
Diphenyl phosphite; diphenyl phosphonate; Phosphonic acid diphenyl ester; diphenyl hydrogen phosphite; oxo(diphenoxy)phosphonium |
| आणविक फार्मूला |
C12H11O3P |
| आण्विक वजन |
234.1877 |
| InChI |
InChI=1/C12H11O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,16H |
| कैस रजिस्टी संख्या |
4712-55-4 |
| EINECS |
225-202-8 |
| आणविक संरचना |
|
| गलनांक |
12℃ |
| उबलने का समय |
348.233°C at 760 mmHg |
| फ्लैश प्वाइंट |
178.834°C |
| वाष्प का दबाव |
0mmHg at 25°C |
| खतरा प्रतीक |
 C:Corrosive;
|
| खतरे के कोड |
R34:Causes burns.;
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
