ChemNet > CAS > 4755-50-4 4-Dimethylaminobenzoylchloride
4755-50-4 4-Dimethylaminobenzoylchloride
उत्पाद का नाम |
4-Dimethylaminobenzoylchloride |
अंग्रेजी नाम |
4-Dimethylaminobenzoylchloride; 4-Dimethylaminobenzoyl chloride; 4-(ethylamino)benzoyl chloride |
आणविक फार्मूला |
C9H10ClNO |
आण्विक वजन |
183.6348 |
InChI |
InChI=1/C9H10ClNO/c1-11(2)8-5-3-7(4-6-8)9(10)12/h3-6H,1-2H3 |
कैस रजिस्टी संख्या |
4755-50-4 |
आणविक संरचना |
|
घनत्व |
1.193g/cm3 |
उबलने का समय |
279°C at 760 mmHg |
अपवर्तक सूचकांक |
1.574 |
फ्लैश प्वाइंट |
122.5°C |
वाष्प का दबाव |
0.00412mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|