ChemNet > CAS > 488-87-9 2,5-डाइमिथाइलरेसोर्सिनोल
488-87-9 2,5-डाइमिथाइलरेसोर्सिनोल
| उत्पाद का नाम |
2,5-डाइमिथाइलरेसोर्सिनोल |
| समानार्थी |
2,5-डाइमिथाइलबेनज़ीन-1,3-डायोल |
| अंग्रेजी नाम |
2,5-Dimethylresorcinol;2,5-dimethylbenzene-1,3-diol |
| आणविक फार्मूला |
C8H10O2 |
| आण्विक वजन |
138.1638 |
| InChI |
InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
| कैस रजिस्टी संख्या |
488-87-9 |
| EINECS |
207-688-3 |
| आणविक संरचना |
|
| घनत्व |
1.162g/cm3 |
| गलनांक |
161℃ |
| उबलने का समय |
284.1°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.582 |
| फ्लैश प्वाइंट |
140.8°C |
| वाष्प का दबाव |
0.00178mmHg at 25°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
