ChemNet > CAS > 4917-76-4 thiodi(succinic acid)
4917-76-4 thiodi(succinic acid)
| उत्पाद का नाम |
thiodi(succinic acid) |
| अंग्रेजी नाम |
thiodi(succinic acid); Thiodisuccinicacid; Thiodisuccinic acid; 2,2'-sulfanediyldibutanedioic acid |
| आणविक फार्मूला |
C7H5FN2 |
| आण्विक वजन |
136.1264 |
| InChI |
InChI=1/C7H5FN2/c8-6-2-4-10-7-5(6)1-3-9-7/h1-4H,(H,9,10) |
| कैस रजिस्टी संख्या |
4917-76-4 |
| EINECS |
225-544-8 |
| आणविक संरचना |
|
| घनत्व |
1.371g/cm3 |
| अपवर्तक सूचकांक |
1.659 |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
