ChemNet > CAS > 50529-33-4 3-chloro-4-(fluorophenyl)isocyanate
50529-33-4 3-chloro-4-(fluorophenyl)isocyanate
| उत्पाद का नाम |
3-chloro-4-(fluorophenyl)isocyanate |
| अंग्रेजी नाम |
3-chloro-4-(fluorophenyl)isocyanate; 3-Chloro-4-fluorophenyl isocyanate; 2-chloro-1-fluoro-4-isocyanatobenzene |
| आणविक फार्मूला |
C7H3ClFNO |
| आण्विक वजन |
171.5562 |
| InChI |
InChI=1/C7H3ClFNO/c8-6-3-5(10-4-11)1-2-7(6)9/h1-3H |
| कैस रजिस्टी संख्या |
50529-33-4 |
| आणविक संरचना |
|
| घनत्व |
1.31g/cm3 |
| उबलने का समय |
228.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.533 |
| फ्लैश प्वाइंट |
92.1°C |
| वाष्प का दबाव |
0.0723mmHg at 25°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R23/25:Toxic by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
