ChemNet > CAS > 50533-97-6 4-dimethylaminopiperidine
50533-97-6 4-dimethylaminopiperidine
उत्पाद का नाम |
4-dimethylaminopiperidine |
अंग्रेजी नाम |
4-dimethylaminopiperidine; 4-(Dimethylamino)piperidine; N,N-dimethylpiperidin-4-amine |
आणविक फार्मूला |
C7H16N2 |
आण्विक वजन |
128.2153 |
InChI |
InChI=1/C7H16N2/c1-9(2)7-3-5-8-6-4-7/h7-8H,3-6H2,1-2H3 |
कैस रजिस्टी संख्या |
50533-97-6 |
EINECS |
256-617-2 |
आणविक संरचना |
|
घनत्व |
0.91g/cm3 |
उबलने का समय |
179.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.479 |
फ्लैश प्वाइंट |
63.3°C |
वाष्प का दबाव |
0.929mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R10:Flammable.;
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|